About tetraoctylazanium;hydrobromide;hydrochloride
tetraoctylazanium;hydrobromide;hydrochloride (PubChem CID 87961078) has the molecular formula C32H70BrClN+
and a molecular weight of 584.28 g/mol. Its IUPAC name is tetraoctylazanium;hydrobromide;hydrochloride.
Molecular Properties
| Compound Name | tetraoctylazanium;hydrobromide;hydrochloride |
| PubChem CID | 87961078 |
| Molecular Formula | C32H70BrClN+ |
| Molecular Weight | 584.28 g/mol |
| Exact Mass | 582.44 |
| IUPAC Name | tetraoctylazanium;hydrobromide;hydrochloride |
| SMILES | Br.CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.Cl |
| InChI | InChI=1S/C32H68N.BrH.ClH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;;/h5-32H2,1-4H3;2*1H/q+1;; |
| InChIKey | CLUXCXZFNRAGCK-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.28 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetraoctylazanium;hydrobromide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraoctylazanium;hydrobromide;hydrochloride?
The IUPAC name of tetraoctylazanium;hydrobromide;hydrochloride (CID 87961078) is tetraoctylazanium;hydrobromide;hydrochloride.
What is the SMILES notation for tetraoctylazanium;hydrobromide;hydrochloride?
The canonical SMILES for tetraoctylazanium;hydrobromide;hydrochloride is Br.CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.Cl.
What is the InChIKey of tetraoctylazanium;hydrobromide;hydrochloride?
The InChIKey is CLUXCXZFNRAGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H68N.BrH.ClH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;;/h5-32H2,1-4H3;2*1H/q+1;;.
What are the key properties of tetraoctylazanium;hydrobromide;hydrochloride?
tetraoctylazanium;hydrobromide;hydrochloride has a molecular weight of 584.28 g/mol, XLogP of 12.24, 28 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraoctylazanium;hydrobromide;hydrochloride is sourced from PubChem (CID 87961078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).