C22H31F17N+ — CID 101266963
tributyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)azanium (PubChem CID 101266963) has the molecular formula C22H31F17N+ and a molecular weight of 632.46 g/mol. Its IUPAC name is tributyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)azanium.
| Compound Name | tributyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)azanium |
|---|---|
| PubChem CID | 101266963 |
| Molecular Formula | C22H31F17N+ |
| Molecular Weight | 632.46 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | tributyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H31F17N/c1-4-7-11-40(12-8-5-2,13-9-6-3)14-10-15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)22(37,38)39/h4-14H2,1-3H3/q+1 |
| InChIKey | UTBRGLNJSKDGGR-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.46 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|