C23H39F13N2+2 — CID 102409926
2-[dimethyl(octyl)azaniumyl]ethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium (PubChem CID 102409926) has the molecular formula C23H39F13N2+2 and a molecular weight of 590.55 g/mol. Its IUPAC name is 2-[dimethyl(octyl)azaniumyl]ethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium.
| Compound Name | 2-[dimethyl(octyl)azaniumyl]ethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium |
|---|---|
| PubChem CID | 102409926 |
| Molecular Formula | C23H39F13N2+2 |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 2-[dimethyl(octyl)azaniumyl]ethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium |
| SMILES | CCCCCCCC[N+](C)(C)CC[N+](C)(C)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H39F13N2/c1-6-7-8-9-10-11-14-37(2,3)16-17-38(4,5)15-12-13-18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36/h6-17H2,1-5H3/q+2 |
| InChIKey | RVTSLCICIRXZGE-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|