C14H19F6NO4S2 — CID 155012693
1,1-bis(trifluoromethylsulfonyl)heptane;pyridine (PubChem CID 155012693) has the molecular formula C14H19F6NO4S2 and a molecular weight of 443.43 g/mol. Its IUPAC name is 1,1-bis(trifluoromethylsulfonyl)heptane;pyridine.
| Compound Name | 1,1-bis(trifluoromethylsulfonyl)heptane;pyridine |
|---|---|
| PubChem CID | 155012693 |
| Molecular Formula | C14H19F6NO4S2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 1,1-bis(trifluoromethylsulfonyl)heptane;pyridine |
| SMILES | CCCCCCC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C9H14F6O4S2.C5H5N/c1-2-3-4-5-6-7(20(16,17)8(10,11)12)21(18,19)9(13,14)15;1-2-4-6-5-3-1/h7H,2-6H2,1H3;1-5H |
| InChIKey | PLHVRMXYFNIIEW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|