About heptan-2-one;pyridine
heptan-2-one;pyridine (PubChem CID 162006039) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is heptan-2-one;pyridine.
Molecular Properties
| Compound Name | heptan-2-one;pyridine |
| PubChem CID | 162006039 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | heptan-2-one;pyridine |
| SMILES | CCCCCC(C)=O.c1ccncc1 |
| InChI | InChI=1S/C7H14O.C5H5N/c1-3-4-5-6-7(2)8;1-2-4-6-5-3-1/h3-6H2,1-2H3;1-5H |
| InChIKey | YSVRQAJWIDPMGR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-one;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-one;pyridine?
The IUPAC name of heptan-2-one;pyridine (CID 162006039) is heptan-2-one;pyridine.
What is the SMILES notation for heptan-2-one;pyridine?
The canonical SMILES for heptan-2-one;pyridine is CCCCCC(C)=O.c1ccncc1.
What is the InChIKey of heptan-2-one;pyridine?
The InChIKey is YSVRQAJWIDPMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C5H5N/c1-3-4-5-6-7(2)8;1-2-4-6-5-3-1/h3-6H2,1-2H3;1-5H.
What are the key properties of heptan-2-one;pyridine?
heptan-2-one;pyridine has a molecular weight of 193.29 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-one;pyridine is sourced from PubChem (CID 162006039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).