About 7-chlorohexadecane;pyridine
7-chlorohexadecane;pyridine (PubChem CID 67860983) has the molecular formula C21H38ClN
and a molecular weight of 339.99 g/mol. Its IUPAC name is 7-chlorohexadecane;pyridine.
Molecular Properties
| Compound Name | 7-chlorohexadecane;pyridine |
| PubChem CID | 67860983 |
| Molecular Formula | C21H38ClN |
| Molecular Weight | 339.99 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 7-chlorohexadecane;pyridine |
| SMILES | CCCCCCCCCC(Cl)CCCCCC.c1ccncc1 |
| InChI | InChI=1S/C16H33Cl.C5H5N/c1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2;1-2-4-6-5-3-1/h16H,3-15H2,1-2H3;1-5H |
| InChIKey | AUMHZVNCZSYGRC-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.99 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-chlorohexadecane;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chlorohexadecane;pyridine?
The IUPAC name of 7-chlorohexadecane;pyridine (CID 67860983) is 7-chlorohexadecane;pyridine.
What is the SMILES notation for 7-chlorohexadecane;pyridine?
The canonical SMILES for 7-chlorohexadecane;pyridine is CCCCCCCCCC(Cl)CCCCCC.c1ccncc1.
What is the InChIKey of 7-chlorohexadecane;pyridine?
The InChIKey is AUMHZVNCZSYGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33Cl.C5H5N/c1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2;1-2-4-6-5-3-1/h16H,3-15H2,1-2H3;1-5H.
What are the key properties of 7-chlorohexadecane;pyridine?
7-chlorohexadecane;pyridine has a molecular weight of 339.99 g/mol, XLogP of 7.79, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chlorohexadecane;pyridine is sourced from PubChem (CID 67860983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).