About 3-chlorohenicosane
3-chlorohenicosane (PubChem CID 87067964) has the molecular formula C21H43Cl
and a molecular weight of 331.03 g/mol. Its IUPAC name is 3-chlorohenicosane.
Molecular Properties
| Compound Name | 3-chlorohenicosane |
| PubChem CID | 87067964 |
| Molecular Formula | C21H43Cl |
| Molecular Weight | 331.03 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | 3-chlorohenicosane |
| SMILES | CCCCCCCCCCCCCCCCCCC(Cl)CC |
| InChI | InChI=1S/C21H43Cl/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)4-2/h21H,3-20H2,1-2H3 |
| InChIKey | AGGSXADJTGLARB-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.03 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorohenicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorohenicosane?
The IUPAC name of 3-chlorohenicosane (CID 87067964) is 3-chlorohenicosane.
What is the SMILES notation for 3-chlorohenicosane?
The canonical SMILES for 3-chlorohenicosane is CCCCCCCCCCCCCCCCCCC(Cl)CC.
What is the InChIKey of 3-chlorohenicosane?
The InChIKey is AGGSXADJTGLARB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43Cl/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)4-2/h21H,3-20H2,1-2H3.
What are the key properties of 3-chlorohenicosane?
3-chlorohenicosane has a molecular weight of 331.03 g/mol, XLogP of 8.66, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorohenicosane is sourced from PubChem (CID 87067964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).