About azane;1,3-dichloropentadecane
azane;1,3-dichloropentadecane (PubChem CID 87123860) has the molecular formula C15H36Cl2N2
and a molecular weight of 315.37 g/mol. Its IUPAC name is azane;1,3-dichloropentadecane.
Molecular Properties
| Compound Name | azane;1,3-dichloropentadecane |
| PubChem CID | 87123860 |
| Molecular Formula | C15H36Cl2N2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | azane;1,3-dichloropentadecane |
| SMILES | CCCCCCCCCCCCC(Cl)CCCl.N.N |
| InChI | InChI=1S/C15H30Cl2.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-14-16;;/h15H,2-14H2,1H3;2*1H3 |
| InChIKey | VWCSVDPRQDKUEG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;1,3-dichloropentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,3-dichloropentadecane?
The IUPAC name of azane;1,3-dichloropentadecane (CID 87123860) is azane;1,3-dichloropentadecane.
What is the SMILES notation for azane;1,3-dichloropentadecane?
The canonical SMILES for azane;1,3-dichloropentadecane is CCCCCCCCCCCCC(Cl)CCCl.N.N.
What is the InChIKey of azane;1,3-dichloropentadecane?
The InChIKey is VWCSVDPRQDKUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30Cl2.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-14-16;;/h15H,2-14H2,1H3;2*1H3.
What are the key properties of azane;1,3-dichloropentadecane?
azane;1,3-dichloropentadecane has a molecular weight of 315.37 g/mol, XLogP of 6.86, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,3-dichloropentadecane is sourced from PubChem (CID 87123860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).