About 3-chlorohexadecane
3-chlorohexadecane (PubChem CID 63459281) has the molecular formula C16H33Cl
and a molecular weight of 260.89 g/mol. Its IUPAC name is 3-chlorohexadecane.
Molecular Properties
| Compound Name | 3-chlorohexadecane |
| PubChem CID | 63459281 |
| Molecular Formula | C16H33Cl |
| Molecular Weight | 260.89 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 3-chlorohexadecane |
| SMILES | CCCCCCCCCCCCCC(Cl)CC |
| InChI | InChI=1S/C16H33Cl/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)4-2/h16H,3-15H2,1-2H3 |
| InChIKey | OSDAOMNTXMOBGR-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.89 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorohexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorohexadecane?
The IUPAC name of 3-chlorohexadecane (CID 63459281) is 3-chlorohexadecane.
What is the SMILES notation for 3-chlorohexadecane?
The canonical SMILES for 3-chlorohexadecane is CCCCCCCCCCCCCC(Cl)CC.
What is the InChIKey of 3-chlorohexadecane?
The InChIKey is OSDAOMNTXMOBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33Cl/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)4-2/h16H,3-15H2,1-2H3.
What are the key properties of 3-chlorohexadecane?
3-chlorohexadecane has a molecular weight of 260.89 g/mol, XLogP of 6.70, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorohexadecane is sourced from PubChem (CID 63459281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).