About 1-bromo-8-chlorodecane
1-bromo-8-chlorodecane (PubChem CID 87925762) has the molecular formula C10H20BrCl
and a molecular weight of 255.63 g/mol. Its IUPAC name is 1-bromo-8-chlorodecane.
Molecular Properties
| Compound Name | 1-bromo-8-chlorodecane |
| PubChem CID | 87925762 |
| Molecular Formula | C10H20BrCl |
| Molecular Weight | 255.63 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-bromo-8-chlorodecane |
| SMILES | CCC(Cl)CCCCCCCBr |
| InChI | InChI=1S/C10H20BrCl/c1-2-10(12)8-6-4-3-5-7-9-11/h10H,2-9H2,1H3 |
| InChIKey | JFRXAUDNGBFLMP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-8-chlorodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-8-chlorodecane?
The IUPAC name of 1-bromo-8-chlorodecane (CID 87925762) is 1-bromo-8-chlorodecane.
What is the SMILES notation for 1-bromo-8-chlorodecane?
The canonical SMILES for 1-bromo-8-chlorodecane is CCC(Cl)CCCCCCCBr.
What is the InChIKey of 1-bromo-8-chlorodecane?
The InChIKey is JFRXAUDNGBFLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrCl/c1-2-10(12)8-6-4-3-5-7-9-11/h10H,2-9H2,1H3.
What are the key properties of 1-bromo-8-chlorodecane?
1-bromo-8-chlorodecane has a molecular weight of 255.63 g/mol, XLogP of 4.74, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-8-chlorodecane is sourced from PubChem (CID 87925762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).