About 1-bromo-5-chloroheptane
1-bromo-5-chloroheptane (PubChem CID 141486133) has the molecular formula C7H14BrCl
and a molecular weight of 213.55 g/mol. Its IUPAC name is 1-bromo-5-chloroheptane.
Molecular Properties
| Compound Name | 1-bromo-5-chloroheptane |
| PubChem CID | 141486133 |
| Molecular Formula | C7H14BrCl |
| Molecular Weight | 213.55 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 1-bromo-5-chloroheptane |
| SMILES | CCC(Cl)CCCCBr |
| InChI | InChI=1S/C7H14BrCl/c1-2-7(9)5-3-4-6-8/h7H,2-6H2,1H3 |
| InChIKey | VSAYIKKDTJFEAH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5-chloroheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5-chloroheptane?
The IUPAC name of 1-bromo-5-chloroheptane (CID 141486133) is 1-bromo-5-chloroheptane.
What is the SMILES notation for 1-bromo-5-chloroheptane?
The canonical SMILES for 1-bromo-5-chloroheptane is CCC(Cl)CCCCBr.
What is the InChIKey of 1-bromo-5-chloroheptane?
The InChIKey is VSAYIKKDTJFEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrCl/c1-2-7(9)5-3-4-6-8/h7H,2-6H2,1H3.
What are the key properties of 1-bromo-5-chloroheptane?
1-bromo-5-chloroheptane has a molecular weight of 213.55 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5-chloroheptane is sourced from PubChem (CID 141486133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).