C7HF15O6S3 — CID 59409367
1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane (PubChem CID 59409367) has the molecular formula C7HF15O6S3 and a molecular weight of 562.25 g/mol. Its IUPAC name is 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane.
| Compound Name | 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 59409367 |
| Molecular Formula | C7HF15O6S3 |
| Molecular Weight | 562.25 g/mol |
| Exact Mass | 561.87 |
| IUPAC Name | 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane |
| SMILES | O=S(=O)(C(S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF15O6S3/c8-2(9,10)5(17,18)29(23,24)1(30(25,26)6(19,20)3(11,12)13)31(27,28)7(21,22)4(14,15)16/h1H |
| InChIKey | CAKDDIRYHQGITO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|