C11HF15O4S2 — CID 59584279
1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 59584279) has the molecular formula C11HF15O4S2 and a molecular weight of 546.23 g/mol. Its IUPAC name is 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 59584279 |
| Molecular Formula | C11HF15O4S2 |
| Molecular Weight | 546.23 g/mol |
| Exact Mass | 545.91 |
| IUPAC Name | 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | O=S(=O)(C(c1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11HF15O4S2/c12-2-1(3(13)5(15)6(16)4(2)14)7(31(27,28)10(23,24)8(17,18)19)32(29,30)11(25,26)9(20,21)22/h7H |
| InChIKey | FBHVHYAIPSTHOY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|