C17HF19 — CID 146582391
1,2,3,4,5-pentafluoro-6-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(2,3,4,5,6-pentafluorophenyl)pentyl]benzene (PubChem CID 146582391) has the molecular formula C17HF19 and a molecular weight of 566.16 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(2,3,4,5,6-pentafluorophenyl)pentyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(2,3,4,5,6-pentafluorophenyl)pentyl]benzene |
|---|---|
| PubChem CID | 146582391 |
| Molecular Formula | C17HF19 |
| Molecular Weight | 566.16 g/mol |
| Exact Mass | 565.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(2,3,4,5,6-pentafluorophenyl)pentyl]benzene |
| SMILES | Fc1c(F)c(F)c(C(c2c(F)c(F)c(F)c(F)c2F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C17HF19/c18-4-1(5(19)9(23)12(26)8(4)22)3(2-6(20)10(24)13(27)11(25)7(2)21)14(28,29)15(30,31)16(32,33)17(34,35)36/h3H |
| InChIKey | QMSXJZCMSBRFNG-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.16 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|