C20F26S — CID 139824296
1,2,3,4-tetrafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylbenzene (PubChem CID 139824296) has the molecular formula C20F26S and a molecular weight of 766.23 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylbenzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 139824296 |
| Molecular Formula | C20F26S |
| Molecular Weight | 766.23 g/mol |
| Exact Mass | 765.93 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylbenzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Sc2c(F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C20F26S/c21-3-1(13(29,30)15(33,34)17(37,38)19(41,42)43)11(9(27)7(25)5(3)23)47-12-2(4(22)6(24)8(26)10(12)28)14(31,32)16(35,36)18(39,40)20(44,45)46 |
| InChIKey | OPRREZVCXLWXDD-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.23 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|