C19HF31O — CID 139749074
2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)-6-(trifluoromethyl)phenol (PubChem CID 139749074) has the molecular formula C19HF31O and a molecular weight of 834.15 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)-6-(trifluoromethyl)phenol.
| Compound Name | 2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 139749074 |
| Molecular Formula | C19HF31O |
| Molecular Weight | 834.15 g/mol |
| Exact Mass | 833.95 |
| IUPAC Name | 2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)-6-(trifluoromethyl)phenol |
| SMILES | Oc1c(F)c(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C19HF31O/c20-3-1(2(8(25,26)27)6(51)5(22)4(3)21)7(23,24)9(28,29)10(30,31)11(32,33)12(34,35)13(36,37)14(38,39)15(40,41)16(42,43)17(44,45)18(46,47)19(48,49)50/h51H |
| InChIKey | UABWMOGAFVKZDY-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.15 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|