C8HF9O3 — CID 88927792
3-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclobut-3-ene-1,2-dione (PubChem CID 88927792) has the molecular formula C8HF9O3 and a molecular weight of 316.08 g/mol. Its IUPAC name is 3-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 88927792 |
| Molecular Formula | C8HF9O3 |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 3-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(O)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=O |
| InChI | InChI=1S/C8HF9O3/c9-5(10,1-2(18)4(20)3(1)19)6(11,12)7(13,14)8(15,16)17/h18H |
| InChIKey | FTIOZTARBRGBNF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|