C5H2O5 — CID 546874
4,5-dihydroxycyclopent-4-ene-1,2,3-trione (PubChem CID 546874) has the molecular formula C5H2O5 and a molecular weight of 142.07 g/mol. Its IUPAC name is 4,5-dihydroxycyclopent-4-ene-1,2,3-trione.
| Compound Name | 4,5-dihydroxycyclopent-4-ene-1,2,3-trione |
|---|---|
| PubChem CID | 546874 |
| Molecular Formula | C5H2O5 |
| Molecular Weight | 142.07 g/mol |
| Exact Mass | 141.99 |
| IUPAC Name | 4,5-dihydroxycyclopent-4-ene-1,2,3-trione |
| SMILES | O=c1c(O)c(O)c(=O)c1=O |
| InChI | InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H |
| InChIKey | RBSLJAJQOVYTRQ-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.07 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|