C5H8O8 — CID 67762226
4,5-dihydroxycyclopent-4-ene-1,2,3-trione;trihydrate (PubChem CID 67762226) has the molecular formula C5H8O8 and a molecular weight of 196.11 g/mol. Its IUPAC name is 4,5-dihydroxycyclopent-4-ene-1,2,3-trione;trihydrate.
| Compound Name | 4,5-dihydroxycyclopent-4-ene-1,2,3-trione;trihydrate |
|---|---|
| PubChem CID | 67762226 |
| Molecular Formula | C5H8O8 |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4,5-dihydroxycyclopent-4-ene-1,2,3-trione;trihydrate |
| SMILES | O.O.O.O=c1c(O)c(O)c(=O)c1=O |
| InChI | InChI=1S/C5H2O5.3H2O/c6-1-2(7)4(9)5(10)3(1)8;;;/h6-7H;3*1H2 |
| InChIKey | DOAJLCUFLXYQJA-UHFFFAOYSA-N |
| XLogP | -4.42 |
| TPSA | 186.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|