C8H11NO3 — CID 86025532
3-(1-amino-2-methylpropyl)-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 86025532) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 3-(1-amino-2-methylpropyl)-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1-amino-2-methylpropyl)-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 86025532 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-(1-amino-2-methylpropyl)-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CC(C)C(N)c1c(O)c(=O)c1=O |
| InChI | InChI=1S/C8H11NO3/c1-3(2)5(9)4-6(10)8(12)7(4)11/h3,5,10H,9H2,1-2H3 |
| InChIKey | FZAWELBTMOLOGN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|