C9H13NO3 — CID 130739530
3-[(2S)-1-amino-2-methylbutyl]-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 130739530) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-[(2S)-1-amino-2-methylbutyl]-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2S)-1-amino-2-methylbutyl]-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 130739530 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-[(2S)-1-amino-2-methylbutyl]-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CC[C@H](C)C(N)c1c(O)c(=O)c1=O |
| InChI | InChI=1S/C9H13NO3/c1-3-4(2)6(10)5-7(11)9(13)8(5)12/h4,6,11H,3,10H2,1-2H3/t4-,6?/m0/s1 |
| InChIKey | TZVNDQIHAKZSAO-VKZKZBKNSA-N |
| XLogP | 0.03 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|