C10H15NO3 — CID 55270365
5-(1-amino-2-methylpropyl)benzene-1,2,3-triol (PubChem CID 55270365) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 5-(1-amino-2-methylpropyl)benzene-1,2,3-triol.
| Compound Name | 5-(1-amino-2-methylpropyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 55270365 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 5-(1-amino-2-methylpropyl)benzene-1,2,3-triol |
| SMILES | CC(C)C(N)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H15NO3/c1-5(2)9(11)6-3-7(12)10(14)8(13)4-6/h3-5,9,12-14H,11H2,1-2H3 |
| InChIKey | FJNKYLLVNNWEKO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|