C8H11NO3 — CID 55295720
5-(1-aminoethyl)benzene-1,2,3-triol (PubChem CID 55295720) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(1-aminoethyl)benzene-1,2,3-triol.
| Compound Name | 5-(1-aminoethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 55295720 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-(1-aminoethyl)benzene-1,2,3-triol |
| SMILES | CC(N)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3/c1-4(9)5-2-6(10)8(12)7(11)3-5/h2-4,10-12H,9H2,1H3 |
| InChIKey | DITMLSQJKUUXIX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|