C6H6O4 — CID 19591430
3-ethoxy-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 19591430) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is 3-ethoxy-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-ethoxy-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 19591430 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 3-ethoxy-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(O)c(=O)c1=O |
| InChI | InChI=1S/C6H6O4/c1-2-10-6-4(8)3(7)5(6)9/h8H,2H2,1H3 |
| InChIKey | OHHYZFKYCUKQBI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|