C8H8N2O7 — CID 139703790
2-ethoxy-4,6-dinitrobenzene-1,3-diol (PubChem CID 139703790) has the molecular formula C8H8N2O7 and a molecular weight of 244.16 g/mol. Its IUPAC name is 2-ethoxy-4,6-dinitrobenzene-1,3-diol.
| Compound Name | 2-ethoxy-4,6-dinitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 139703790 |
| Molecular Formula | C8H8N2O7 |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-ethoxy-4,6-dinitrobenzene-1,3-diol |
| SMILES | CCOc1c(O)c([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H8N2O7/c1-2-17-8-6(11)4(9(13)14)3-5(7(8)12)10(15)16/h3,11-12H,2H2,1H3 |
| InChIKey | RWFLMXVGIHQFDM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|