C10H12N2O7 — CID 156633172
2,3-diethoxy-4,6-dinitrophenol (PubChem CID 156633172) has the molecular formula C10H12N2O7 and a molecular weight of 272.21 g/mol. Its IUPAC name is 2,3-diethoxy-4,6-dinitrophenol.
| Compound Name | 2,3-diethoxy-4,6-dinitrophenol |
|---|---|
| PubChem CID | 156633172 |
| Molecular Formula | C10H12N2O7 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2,3-diethoxy-4,6-dinitrophenol |
| SMILES | CCOc1c([N+](=O)[O-])cc([N+](=O)[O-])c(O)c1OCC |
| InChI | InChI=1S/C10H12N2O7/c1-3-18-9-7(12(16)17)5-6(11(14)15)8(13)10(9)19-4-2/h5,13H,3-4H2,1-2H3 |
| InChIKey | DUCFCWXZAKFCRQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|