C14H14NO7- — CID 6935730
6,7-diethoxy-3-methyl-5-nitro-1-benzofuran-2-carboxylate (PubChem CID 6935730) has the molecular formula C14H14NO7- and a molecular weight of 308.27 g/mol. Its IUPAC name is 6,7-diethoxy-3-methyl-5-nitro-1-benzofuran-2-carboxylate.
| Compound Name | 6,7-diethoxy-3-methyl-5-nitro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 6935730 |
| Molecular Formula | C14H14NO7- |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 6,7-diethoxy-3-methyl-5-nitro-1-benzofuran-2-carboxylate |
| SMILES | CCOc1c([N+](=O)[O-])cc2c(C)c(C(=O)[O-])oc2c1OCC |
| InChI | InChI=1S/C14H15NO7/c1-4-20-12-9(15(18)19)6-8-7(3)10(14(16)17)22-11(8)13(12)21-5-2/h6H,4-5H2,1-3H3,(H,16,17)/p-1 |
| InChIKey | LTQJUWPGVPHZLC-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 114.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|