C15H22N2O6 — CID 13421472
propan-2-yl N-(3,4-diethoxy-5-nitrophenyl)-N-methylcarbamate (PubChem CID 13421472) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is propan-2-yl N-(3,4-diethoxy-5-nitrophenyl)-N-methylcarbamate.
| Compound Name | propan-2-yl N-(3,4-diethoxy-5-nitrophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 13421472 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | propan-2-yl N-(3,4-diethoxy-5-nitrophenyl)-N-methylcarbamate |
| SMILES | CCOc1cc(N(C)C(=O)OC(C)C)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C15H22N2O6/c1-6-21-13-9-11(16(5)15(18)23-10(3)4)8-12(17(19)20)14(13)22-7-2/h8-10H,6-7H2,1-5H3 |
| InChIKey | SJZPLGRNRNUMEY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|