C10H9NO5 — CID 171003716
4-ethoxy-5-nitrobenzene-1,3-dicarbaldehyde (PubChem CID 171003716) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is 4-ethoxy-5-nitrobenzene-1,3-dicarbaldehyde.
| Compound Name | 4-ethoxy-5-nitrobenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 171003716 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-ethoxy-5-nitrobenzene-1,3-dicarbaldehyde |
| SMILES | CCOc1c(C=O)cc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9NO5/c1-2-16-10-8(6-13)3-7(5-12)4-9(10)11(14)15/h3-6H,2H2,1H3 |
| InChIKey | VWQAQGOROJNOCC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|