C20H20N4O14 — CID 160927262
4,5-diethoxy-2,3-dinitrobenzaldehyde;5-ethoxy-4-hydroxy-2,3-dinitrobenzaldehyde (PubChem CID 160927262) has the molecular formula C20H20N4O14 and a molecular weight of 540.39 g/mol. Its IUPAC name is 4,5-diethoxy-2,3-dinitrobenzaldehyde;5-ethoxy-4-hydroxy-2,3-dinitrobenzaldehyde.
| Compound Name | 4,5-diethoxy-2,3-dinitrobenzaldehyde;5-ethoxy-4-hydroxy-2,3-dinitrobenzaldehyde |
|---|---|
| PubChem CID | 160927262 |
| Molecular Formula | C20H20N4O14 |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | 4,5-diethoxy-2,3-dinitrobenzaldehyde;5-ethoxy-4-hydroxy-2,3-dinitrobenzaldehyde |
| SMILES | CCOc1cc(C=O)c([N+](=O)[O-])c([N+](=O)[O-])c1O.CCOc1cc(C=O)c([N+](=O)[O-])c([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C11H12N2O7.C9H8N2O7/c1-3-19-8-5-7(6-14)9(12(15)16)10(13(17)18)11(8)20-4-2;1-2-18-6-3-5(4-12)7(10(14)15)8(9(6)13)11(16)17/h5-6H,3-4H2,1-2H3;3-4,13H,2H2,1H3 |
| InChIKey | SSUNQLUGPYOVHL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 254.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|