About 2-ethoxy-3,5-dinitrobenzonitrile
2-ethoxy-3,5-dinitrobenzonitrile (PubChem CID 4527967) has the molecular formula C9H7N3O5
and a molecular weight of 237.17 g/mol. Its IUPAC name is 2-ethoxy-3,5-dinitrobenzonitrile.
Molecular Properties
| Compound Name | 2-ethoxy-3,5-dinitrobenzonitrile |
| PubChem CID | 4527967 |
| Molecular Formula | C9H7N3O5 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-ethoxy-3,5-dinitrobenzonitrile |
| SMILES | CCOc1c(C#N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N3O5/c1-2-17-9-6(5-10)3-7(11(13)14)4-8(9)12(15)16/h3-4H,2H2,1H3 |
| InChIKey | YHGJVIFBXCFQRM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3,5-dinitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3,5-dinitrobenzonitrile?
The IUPAC name of 2-ethoxy-3,5-dinitrobenzonitrile (CID 4527967) is 2-ethoxy-3,5-dinitrobenzonitrile.
What is the SMILES notation for 2-ethoxy-3,5-dinitrobenzonitrile?
The canonical SMILES for 2-ethoxy-3,5-dinitrobenzonitrile is CCOc1c(C#N)cc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-ethoxy-3,5-dinitrobenzonitrile?
The InChIKey is YHGJVIFBXCFQRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O5/c1-2-17-9-6(5-10)3-7(11(13)14)4-8(9)12(15)16/h3-4H,2H2,1H3.
What are the key properties of 2-ethoxy-3,5-dinitrobenzonitrile?
2-ethoxy-3,5-dinitrobenzonitrile has a molecular weight of 237.17 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3,5-dinitrobenzonitrile is sourced from PubChem (CID 4527967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).