C10H11N3O7 — CID 13463049
2-butoxy-1,3,5-trinitrobenzene (PubChem CID 13463049) has the molecular formula C10H11N3O7 and a molecular weight of 285.21 g/mol. Its IUPAC name is 2-butoxy-1,3,5-trinitrobenzene.
| Compound Name | 2-butoxy-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 13463049 |
| Molecular Formula | C10H11N3O7 |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-butoxy-1,3,5-trinitrobenzene |
| SMILES | CCCCOc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N3O7/c1-2-3-4-20-10-8(12(16)17)5-7(11(14)15)6-9(10)13(18)19/h5-6H,2-4H2,1H3 |
| InChIKey | VTONLVQOOKHXRT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|