C14H20FNO4 — CID 174682537
1,2-dibutoxy-3-fluoro-4-nitrobenzene (PubChem CID 174682537) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1,2-dibutoxy-3-fluoro-4-nitrobenzene.
| Compound Name | 1,2-dibutoxy-3-fluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 174682537 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1,2-dibutoxy-3-fluoro-4-nitrobenzene |
| SMILES | CCCCOc1ccc([N+](=O)[O-])c(F)c1OCCCC |
| InChI | InChI=1S/C14H20FNO4/c1-3-5-9-19-12-8-7-11(16(17)18)13(15)14(12)20-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | BCIWAVLCGAQDAE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|