C15H22FNO4 — CID 174611948
1,3-dibutoxy-2-fluoro-4-methyl-5-nitrobenzene (PubChem CID 174611948) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is 1,3-dibutoxy-2-fluoro-4-methyl-5-nitrobenzene.
| Compound Name | 1,3-dibutoxy-2-fluoro-4-methyl-5-nitrobenzene |
|---|---|
| PubChem CID | 174611948 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1,3-dibutoxy-2-fluoro-4-methyl-5-nitrobenzene |
| SMILES | CCCCOc1cc([N+](=O)[O-])c(C)c(OCCCC)c1F |
| InChI | InChI=1S/C15H22FNO4/c1-4-6-8-20-13-10-12(17(18)19)11(3)15(14(13)16)21-9-7-5-2/h10H,4-9H2,1-3H3 |
| InChIKey | URARZRAZLPNHIT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|