C42H57N3O12 — CID 100951753
2,3,6,7,10,11-hexabutoxy-1,5,9-trinitrotriphenylene (PubChem CID 100951753) has the molecular formula C42H57N3O12 and a molecular weight of 795.93 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexabutoxy-1,5,9-trinitrotriphenylene.
| Compound Name | 2,3,6,7,10,11-hexabutoxy-1,5,9-trinitrotriphenylene |
|---|---|
| PubChem CID | 100951753 |
| Molecular Formula | C42H57N3O12 |
| Molecular Weight | 795.93 g/mol |
| Exact Mass | 795.39 |
| IUPAC Name | 2,3,6,7,10,11-hexabutoxy-1,5,9-trinitrotriphenylene |
| SMILES | CCCCOc1cc2c(c([N+](=O)[O-])c1OCCCC)c1cc(OCCCC)c(OCCCC)c([N+](=O)[O-])c1c1cc(OCCCC)c(OCCCC)c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C42H57N3O12/c1-7-13-19-52-31-25-28-34(37(43(46)47)40(31)55-22-16-10-4)29-26-32(53-20-14-8-2)42(57-24-18-12-6)39(45(50)51)36(29)30-27-33(54-21-15-9-3)41(56-23-17-11-5)38(35(28)30)44(48)49/h25-27H,7-24H2,1-6H3 |
| InChIKey | HEPRMEFACKWDPK-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 184.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.93 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|