C48H71NO8 — CID 15488138
1-nitro-2,3,6,7,10,11-hexapentoxytriphenylene (PubChem CID 15488138) has the molecular formula C48H71NO8 and a molecular weight of 790.09 g/mol. Its IUPAC name is 1-nitro-2,3,6,7,10,11-hexapentoxytriphenylene.
| Compound Name | 1-nitro-2,3,6,7,10,11-hexapentoxytriphenylene |
|---|---|
| PubChem CID | 15488138 |
| Molecular Formula | C48H71NO8 |
| Molecular Weight | 790.09 g/mol |
| Exact Mass | 789.52 |
| IUPAC Name | 1-nitro-2,3,6,7,10,11-hexapentoxytriphenylene |
| SMILES | CCCCCOc1cc2c3cc(OCCCCC)c(OCCCCC)cc3c3c([N+](=O)[O-])c(OCCCCC)c(OCCCCC)cc3c2cc1OCCCCC |
| InChI | InChI=1S/C48H71NO8/c1-7-13-19-25-52-41-31-36-37-32-43(54-27-21-15-9-3)44(55-28-22-16-10-4)34-39(37)46-40(38(36)33-42(41)53-26-20-14-8-2)35-45(56-29-23-17-11-5)48(47(46)49(50)51)57-30-24-18-12-6/h31-35H,7-30H2,1-6H3 |
| InChIKey | MYDGBKWMZQBCQQ-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.09 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|