C43H61NO8 — CID 100951761
1-nitro-3,6,7,10,11-pentapentoxytriphenylen-2-ol (PubChem CID 100951761) has the molecular formula C43H61NO8 and a molecular weight of 719.96 g/mol. Its IUPAC name is 1-nitro-3,6,7,10,11-pentapentoxytriphenylen-2-ol.
| Compound Name | 1-nitro-3,6,7,10,11-pentapentoxytriphenylen-2-ol |
|---|---|
| PubChem CID | 100951761 |
| Molecular Formula | C43H61NO8 |
| Molecular Weight | 719.96 g/mol |
| Exact Mass | 719.44 |
| IUPAC Name | 1-nitro-3,6,7,10,11-pentapentoxytriphenylen-2-ol |
| SMILES | CCCCCOc1cc2c3cc(OCCCCC)c(OCCCCC)cc3c3c([N+](=O)[O-])c(O)c(OCCCCC)cc3c2cc1OCCCCC |
| InChI | InChI=1S/C43H61NO8/c1-6-11-16-21-48-36-26-31-32-27-38(50-23-18-13-8-3)39(51-24-19-14-9-4)29-34(32)41-35(33(31)28-37(36)49-22-17-12-7-2)30-40(52-25-20-15-10-5)43(45)42(41)44(46)47/h26-30,45H,6-25H2,1-5H3 |
| InChIKey | JPVRHAMAWNMISB-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.96 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|