C66H105ClN2O10 — CID 102112107
12-chloro-1,5-dinitro-2,3,6,7,10,11-hexaoctoxytriphenylene (PubChem CID 102112107) has the molecular formula C66H105ClN2O10 and a molecular weight of 1122.02 g/mol. Its IUPAC name is 12-chloro-1,5-dinitro-2,3,6,7,10,11-hexaoctoxytriphenylene.
| Compound Name | 12-chloro-1,5-dinitro-2,3,6,7,10,11-hexaoctoxytriphenylene |
|---|---|
| PubChem CID | 102112107 |
| Molecular Formula | C66H105ClN2O10 |
| Molecular Weight | 1122.02 g/mol |
| Exact Mass | 1120.75 |
| IUPAC Name | 12-chloro-1,5-dinitro-2,3,6,7,10,11-hexaoctoxytriphenylene |
| SMILES | CCCCCCCCOc1cc2c3cc(OCCCCCCCC)c(OCCCCCCCC)c(Cl)c3c3c([N+](=O)[O-])c(OCCCCCCCC)c(OCCCCCCCC)cc3c2c([N+](=O)[O-])c1OCCCCCCCC |
| InChI | InChI=1S/C66H105ClN2O10/c1-7-13-19-25-31-37-43-74-55-50-53-52-49-56(75-44-38-32-26-20-14-8-2)65(78-47-41-35-29-23-17-11-5)62(68(70)71)58(52)54-51-57(76-45-39-33-27-21-15-9-3)66(79-48-42-36-30-24-18-12-6)63(69(72)73)60(54)59(53)61(67)64(55)77-46-40-34-28-22-16-10-4/h49-51H,7-48H2,1-6H3 |
| InChIKey | LYJAKUNEKLZJRE-UHFFFAOYSA-N |
| XLogP | 22.05 |
| TPSA | 141.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.02 |
| LogP ≤ 5 | 22.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|