C28H39NO7 — CID 102448491
(4-nitrophenyl) 3,4,5-tripentoxybenzoate (PubChem CID 102448491) has the molecular formula C28H39NO7 and a molecular weight of 501.62 g/mol. Its IUPAC name is (4-nitrophenyl) 3,4,5-tripentoxybenzoate.
| Compound Name | (4-nitrophenyl) 3,4,5-tripentoxybenzoate |
|---|---|
| PubChem CID | 102448491 |
| Molecular Formula | C28H39NO7 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (4-nitrophenyl) 3,4,5-tripentoxybenzoate |
| SMILES | CCCCCOc1cc(C(=O)Oc2ccc([N+](=O)[O-])cc2)cc(OCCCCC)c1OCCCCC |
| InChI | InChI=1S/C28H39NO7/c1-4-7-10-17-33-25-20-22(28(30)36-24-15-13-23(14-16-24)29(31)32)21-26(34-18-11-8-5-2)27(25)35-19-12-9-6-3/h13-16,20-21H,4-12,17-19H2,1-3H3 |
| InChIKey | FLLMCPAVPZTANZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|