C50H65NO9 — CID 100970376
(3,5,6,10,11-pentapentoxytriphenylen-2-yl) 4-nitrobenzoate (PubChem CID 100970376) has the molecular formula C50H65NO9 and a molecular weight of 824.07 g/mol. Its IUPAC name is (3,5,6,10,11-pentapentoxytriphenylen-2-yl) 4-nitrobenzoate.
| Compound Name | (3,5,6,10,11-pentapentoxytriphenylen-2-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 100970376 |
| Molecular Formula | C50H65NO9 |
| Molecular Weight | 824.07 g/mol |
| Exact Mass | 823.47 |
| IUPAC Name | (3,5,6,10,11-pentapentoxytriphenylen-2-yl) 4-nitrobenzoate |
| SMILES | CCCCCOc1cc2c(cc1OCCCCC)c1ccc(OCCCCC)c(OCCCCC)c1c1cc(OCCCCC)c(OC(=O)c3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C50H65NO9/c1-6-11-16-27-55-43-26-25-38-39-32-44(56-28-17-12-7-2)45(57-29-18-13-8-3)33-40(39)41-34-47(60-50(52)36-21-23-37(24-22-36)51(53)54)46(58-30-19-14-9-4)35-42(41)48(38)49(43)59-31-20-15-10-5/h21-26,32-35H,6-20,27-31H2,1-5H3 |
| InChIKey | YZKYZJAZJYDEAH-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.07 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|