C48H81N3O5 — CID 102491957
[4-[bis(dimethylamino)methylideneamino]phenyl] 3,4,5-tris-decoxybenzoate (PubChem CID 102491957) has the molecular formula C48H81N3O5 and a molecular weight of 780.19 g/mol. Its IUPAC name is [4-[bis(dimethylamino)methylideneamino]phenyl] 3,4,5-tris-decoxybenzoate.
| Compound Name | [4-[bis(dimethylamino)methylideneamino]phenyl] 3,4,5-tris-decoxybenzoate |
|---|---|
| PubChem CID | 102491957 |
| Molecular Formula | C48H81N3O5 |
| Molecular Weight | 780.19 g/mol |
| Exact Mass | 779.62 |
| IUPAC Name | [4-[bis(dimethylamino)methylideneamino]phenyl] 3,4,5-tris-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1cc(C(=O)Oc2ccc(N=C(N(C)C)N(C)C)cc2)cc(OCCCCCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C48H81N3O5/c1-8-11-14-17-20-23-26-29-36-53-44-39-41(47(52)56-43-34-32-42(33-35-43)49-48(50(4)5)51(6)7)40-45(54-37-30-27-24-21-18-15-12-9-2)46(44)55-38-31-28-25-22-19-16-13-10-3/h32-35,39-40H,8-31,36-38H2,1-7H3 |
| InChIKey | IGILKXZSAVBGHO-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.19 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|