C24H35N3O — CID 101472600
2-[4-(4-heptoxyphenyl)phenyl]-1,1,3,3-tetramethylguanidine (PubChem CID 101472600) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-[4-(4-heptoxyphenyl)phenyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[4-(4-heptoxyphenyl)phenyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 101472600 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | 2-[4-(4-heptoxyphenyl)phenyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CCCCCCCOc1ccc(-c2ccc(N=C(N(C)C)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H35N3O/c1-6-7-8-9-10-19-28-23-17-13-21(14-18-23)20-11-15-22(16-12-20)25-24(26(2)3)27(4)5/h11-18H,6-10,19H2,1-5H3 |
| InChIKey | DFUDLMKCZVTJKB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|