C28H31Cl4N3O11 — CID 157107191
1-butoxy-4-chloro-5-methoxy-2-nitrobenzene;1-chloro-4-ethoxy-2-methoxy-5-nitrobenzene;1,3-dichloro-2-methoxy-4-methyl-5-nitrobenzene (PubChem CID 157107191) has the molecular formula C28H31Cl4N3O11 and a molecular weight of 727.38 g/mol. Its IUPAC name is 1-butoxy-4-chloro-5-methoxy-2-nitrobenzene;1-chloro-4-ethoxy-2-methoxy-5-nitrobenzene;1,3-dichloro-2-methoxy-4-methyl-5-nitrobenzene.
| Compound Name | 1-butoxy-4-chloro-5-methoxy-2-nitrobenzene;1-chloro-4-ethoxy-2-methoxy-5-nitrobenzene;1,3-dichloro-2-methoxy-4-methyl-5-nitrobenzene |
|---|---|
| PubChem CID | 157107191 |
| Molecular Formula | C28H31Cl4N3O11 |
| Molecular Weight | 727.38 g/mol |
| Exact Mass | 725.07 |
| IUPAC Name | 1-butoxy-4-chloro-5-methoxy-2-nitrobenzene;1-chloro-4-ethoxy-2-methoxy-5-nitrobenzene;1,3-dichloro-2-methoxy-4-methyl-5-nitrobenzene |
| SMILES | CCCCOc1cc(OC)c(Cl)cc1[N+](=O)[O-].CCOc1cc(OC)c(Cl)cc1[N+](=O)[O-].COc1c(Cl)cc([N+](=O)[O-])c(C)c1Cl |
| InChI | InChI=1S/C11H14ClNO4.C9H10ClNO4.C8H7Cl2NO3/c1-3-4-5-17-11-7-10(16-2)8(12)6-9(11)13(14)15;1-3-15-9-5-8(14-2)6(10)4-7(9)11(12)13;1-4-6(11(12)13)3-5(9)8(14-2)7(4)10/h6-7H,3-5H2,1-2H3;4-5H,3H2,1-2H3;3H,1-2H3 |
| InChIKey | AGKUWCXXYAKTJJ-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 175.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.38 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|