C14H14ClN3O6 — CID 166440012
4-butoxy-3-chloro-1-methyl-6,8-dinitroquinolin-2-one (PubChem CID 166440012) has the molecular formula C14H14ClN3O6 and a molecular weight of 355.73 g/mol. Its IUPAC name is 4-butoxy-3-chloro-1-methyl-6,8-dinitroquinolin-2-one.
| Compound Name | 4-butoxy-3-chloro-1-methyl-6,8-dinitroquinolin-2-one |
|---|---|
| PubChem CID | 166440012 |
| Molecular Formula | C14H14ClN3O6 |
| Molecular Weight | 355.73 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-butoxy-3-chloro-1-methyl-6,8-dinitroquinolin-2-one |
| SMILES | CCCCOc1c(Cl)c(=O)n(C)c2c([N+](=O)[O-])cc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H14ClN3O6/c1-3-4-5-24-13-9-6-8(17(20)21)7-10(18(22)23)12(9)16(2)14(19)11(13)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZMYBBKKVEQXNOU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 117.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.73 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|