C13H11ClN4O5 — CID 166439088
3-chloro-1-methyl-6,8-dinitro-4-(prop-2-enylamino)quinolin-2-one (PubChem CID 166439088) has the molecular formula C13H11ClN4O5 and a molecular weight of 338.71 g/mol. Its IUPAC name is 3-chloro-1-methyl-6,8-dinitro-4-(prop-2-enylamino)quinolin-2-one.
| Compound Name | 3-chloro-1-methyl-6,8-dinitro-4-(prop-2-enylamino)quinolin-2-one |
|---|---|
| PubChem CID | 166439088 |
| Molecular Formula | C13H11ClN4O5 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-chloro-1-methyl-6,8-dinitro-4-(prop-2-enylamino)quinolin-2-one |
| SMILES | C=CCNc1c(Cl)c(=O)n(C)c2c([N+](=O)[O-])cc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C13H11ClN4O5/c1-3-4-15-11-8-5-7(17(20)21)6-9(18(22)23)12(8)16(2)13(19)10(11)14/h3,5-6,15H,1,4H2,2H3 |
| InChIKey | IRSKICGZQRGLIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|