C16H15N3O8 — CID 101035531
ethyl 2-(1-methyl-6,8-dinitro-2-oxoquinolin-4-yl)-3-oxobutanoate (PubChem CID 101035531) has the molecular formula C16H15N3O8 and a molecular weight of 377.31 g/mol. Its IUPAC name is ethyl 2-(1-methyl-6,8-dinitro-2-oxoquinolin-4-yl)-3-oxobutanoate.
| Compound Name | ethyl 2-(1-methyl-6,8-dinitro-2-oxoquinolin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 101035531 |
| Molecular Formula | C16H15N3O8 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | ethyl 2-(1-methyl-6,8-dinitro-2-oxoquinolin-4-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)c1cc(=O)n(C)c2c([N+](=O)[O-])cc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C16H15N3O8/c1-4-27-16(22)14(8(2)20)10-7-13(21)17(3)15-11(10)5-9(18(23)24)6-12(15)19(25)26/h5-7,14H,4H2,1-3H3 |
| InChIKey | WKBHDYZIDUVYOQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 151.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|