C11H8F3N3O10S — CID 11059081
ethyl 2-(trifluoromethylsulfonyl)-2-(2,4,6-trinitrophenyl)acetate (PubChem CID 11059081) has the molecular formula C11H8F3N3O10S and a molecular weight of 431.26 g/mol. Its IUPAC name is ethyl 2-(trifluoromethylsulfonyl)-2-(2,4,6-trinitrophenyl)acetate.
| Compound Name | ethyl 2-(trifluoromethylsulfonyl)-2-(2,4,6-trinitrophenyl)acetate |
|---|---|
| PubChem CID | 11059081 |
| Molecular Formula | C11H8F3N3O10S |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | ethyl 2-(trifluoromethylsulfonyl)-2-(2,4,6-trinitrophenyl)acetate |
| SMILES | CCOC(=O)C(c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H8F3N3O10S/c1-2-27-10(18)9(28(25,26)11(12,13)14)8-6(16(21)22)3-5(15(19)20)4-7(8)17(23)24/h3-4,9H,2H2,1H3 |
| InChIKey | PYLBMIVDBJCCAK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 189.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|