C11H9F5N2O5 — CID 134682803
ethyl 2-[5-(difluoromethyl)-4-nitro-6-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 134682803) has the molecular formula C11H9F5N2O5 and a molecular weight of 344.19 g/mol. Its IUPAC name is ethyl 2-[5-(difluoromethyl)-4-nitro-6-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-(difluoromethyl)-4-nitro-6-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134682803 |
| Molecular Formula | C11H9F5N2O5 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | ethyl 2-[5-(difluoromethyl)-4-nitro-6-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc([N+](=O)[O-])c(C(F)F)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F5N2O5/c1-2-22-7(19)4-5-3-6(18(20)21)8(9(12)13)10(17-5)23-11(14,15)16/h3,9H,2,4H2,1H3 |
| InChIKey | DEIPCTDDFQLYOS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|