C11H8F4N2O7 — CID 88826610
[2,2,3,3-tetrafluoro-1-(2-methyl-4,6-dinitrophenyl)propyl] hydrogen carbonate (PubChem CID 88826610) has the molecular formula C11H8F4N2O7 and a molecular weight of 356.18 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-1-(2-methyl-4,6-dinitrophenyl)propyl] hydrogen carbonate.
| Compound Name | [2,2,3,3-tetrafluoro-1-(2-methyl-4,6-dinitrophenyl)propyl] hydrogen carbonate |
|---|---|
| PubChem CID | 88826610 |
| Molecular Formula | C11H8F4N2O7 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | [2,2,3,3-tetrafluoro-1-(2-methyl-4,6-dinitrophenyl)propyl] hydrogen carbonate |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(OC(=O)O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H8F4N2O7/c1-4-2-5(16(20)21)3-6(17(22)23)7(4)8(24-10(18)19)11(14,15)9(12)13/h2-3,8-9H,1H3,(H,18,19) |
| InChIKey | WCWZDUIEXNTKBE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|