C7H11N5O7Pt+2 — CID 173080701
azane;(2-methyl-4,6-dinitrophenyl) nitrate;platinum(2+) (PubChem CID 173080701) has the molecular formula C7H11N5O7Pt+2 and a molecular weight of 472.27 g/mol. Its IUPAC name is azane;(2-methyl-4,6-dinitrophenyl) nitrate;platinum(2+).
| Compound Name | azane;(2-methyl-4,6-dinitrophenyl) nitrate;platinum(2+) |
|---|---|
| PubChem CID | 173080701 |
| Molecular Formula | C7H11N5O7Pt+2 |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | azane;(2-methyl-4,6-dinitrophenyl) nitrate;platinum(2+) |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O[N+](=O)[O-].N.N.[Pt+2] |
| InChI | InChI=1S/C7H5N3O7.2H3N.Pt/c1-4-2-5(8(11)12)3-6(9(13)14)7(4)17-10(15)16;;;/h2-3H,1H3;2*1H3;/q;;;+2 |
| InChIKey | NVLSJHPDMSWAGM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 208.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|